C29H24N4S — CID 155609931
(Z)-3-[4-(9,9-dipropylfluoren-2-yl)-2,1,3-benzothiadiazol-7-yl]-2-isocyanoprop-2-enenitrile (PubChem CID 155609931) has the molecular formula C29H24N4S and a molecular weight of 460.61 g/mol. Its IUPAC name is (Z)-3-[4-(9,9-dipropylfluoren-2-yl)-2,1,3-benzothiadiazol-7-yl]-2-isocyanoprop-2-enenitrile.
| Compound Name | (Z)-3-[4-(9,9-dipropylfluoren-2-yl)-2,1,3-benzothiadiazol-7-yl]-2-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 155609931 |
| Molecular Formula | C29H24N4S |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (Z)-3-[4-(9,9-dipropylfluoren-2-yl)-2,1,3-benzothiadiazol-7-yl]-2-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc(-c2ccc3c(c2)C(CCC)(CCC)c2ccccc2-3)c2nsnc12 |
| InChI | InChI=1S/C29H24N4S/c1-4-14-29(15-5-2)25-9-7-6-8-23(25)24-13-10-19(17-26(24)29)22-12-11-20(16-21(18-30)31-3)27-28(22)33-34-32-27/h6-13,16-17H,4-5,14-15H2,1-2H3/b21-16- |
| InChIKey | PLZKJGKWKATGEE-PGMHBOJBSA-N |
| XLogP | 8.01 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|