C37H23N5S3 — CID 153289523
(Z)-3-[4-[2-(9,9-dimethyl-10-phenylacridin-2-yl)thieno[3,2-b]thiophen-5-yl]-2,1,3-benzothiadiazol-7-yl]-2-isocyanoprop-2-enenitrile (PubChem CID 153289523) has the molecular formula C37H23N5S3 and a molecular weight of 633.83 g/mol. Its IUPAC name is (Z)-3-[4-[2-(9,9-dimethyl-10-phenylacridin-2-yl)thieno[3,2-b]thiophen-5-yl]-2,1,3-benzothiadiazol-7-yl]-2-isocyanoprop-2-enenitrile.
| Compound Name | (Z)-3-[4-[2-(9,9-dimethyl-10-phenylacridin-2-yl)thieno[3,2-b]thiophen-5-yl]-2,1,3-benzothiadiazol-7-yl]-2-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 153289523 |
| Molecular Formula | C37H23N5S3 |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.11 |
| IUPAC Name | (Z)-3-[4-[2-(9,9-dimethyl-10-phenylacridin-2-yl)thieno[3,2-b]thiophen-5-yl]-2,1,3-benzothiadiazol-7-yl]-2-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc(-c2cc3sc(-c4ccc5c(c4)C(C)(C)c4ccccc4N5c4ccccc4)cc3s2)c2nsnc12 |
| InChI | InChI=1S/C37H23N5S3/c1-37(2)27-11-7-8-12-29(27)42(25-9-5-4-6-10-25)30-16-14-22(18-28(30)37)31-19-33-34(43-31)20-32(44-33)26-15-13-23(17-24(21-38)39-3)35-36(26)41-45-40-35/h4-20H,1-2H3/b24-17- |
| InChIKey | GUCBDQNZQLVDAO-ULJHMMPZSA-N |
| XLogP | 11.19 |
| TPSA | 57.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|