C39H21N5 — CID 155655323
2-[[7-[(E)-2-cyano-2-isocyanoethenyl]-10-phenylspiro[acridine-9,9'-fluorene]-2-yl]methylidene]propanedinitrile (PubChem CID 155655323) has the molecular formula C39H21N5 and a molecular weight of 559.63 g/mol. Its IUPAC name is 2-[[7-[(E)-2-cyano-2-isocyanoethenyl]-10-phenylspiro[acridine-9,9'-fluorene]-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[7-[(E)-2-cyano-2-isocyanoethenyl]-10-phenylspiro[acridine-9,9'-fluorene]-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 155655323 |
| Molecular Formula | C39H21N5 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 2-[[7-[(E)-2-cyano-2-isocyanoethenyl]-10-phenylspiro[acridine-9,9'-fluorene]-2-yl]methylidene]propanedinitrile |
| SMILES | [C-]#[N+]/C(C#N)=C/c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1cc(C=C(C#N)C#N)ccc1N2c1ccccc1 |
| InChI | InChI=1S/C39H21N5/c1-43-29(25-42)20-27-16-18-38-36(22-27)39(33-13-7-5-11-31(33)32-12-6-8-14-34(32)39)35-21-26(19-28(23-40)24-41)15-17-37(35)44(38)30-9-3-2-4-10-30/h2-22H/b29-20+ |
| InChIKey | GDHIYLXNSHSTJZ-ZTKZIYFRSA-N |
| XLogP | 9.05 |
| TPSA | 78.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|