C42H49IrN3OSi-2 — CID 155610573
iridium;8-[4-(3-methylpentan-3-yl)-2-pyridinyl]-2-propan-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane (PubChem CID 155610573) has the molecular formula C42H49IrN3OSi-2 and a molecular weight of 832.18 g/mol. Its IUPAC name is iridium;8-[4-(3-methylpentan-3-yl)-2-pyridinyl]-2-propan-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane.
| Compound Name | iridium;8-[4-(3-methylpentan-3-yl)-2-pyridinyl]-2-propan-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 155610573 |
| Molecular Formula | C42H49IrN3OSi-2 |
| Molecular Weight | 832.18 g/mol |
| Exact Mass | 832.33 |
| IUPAC Name | iridium;8-[4-(3-methylpentan-3-yl)-2-pyridinyl]-2-propan-2-yl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
| SMILES | CC(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.CCC(C)(CC)c1ccnc(-c2[c-]ccc3c2oc2nc(C(C)C)ccc23)c1.[Ir] |
| InChI | InChI=1S/C25H27N2O.C17H22NSi.Ir/c1-6-25(5,7-2)17-13-14-26-22(15-17)20-10-8-9-18-19-11-12-21(16(3)4)27-24(19)28-23(18)20;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h8-9,11-16H,6-7H2,1-5H3;6-9,11-13H,1-5H3;/q2*-1; |
| InChIKey | PWXNBIHRRVAYNB-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.18 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|