C13H8BrFN2O — CID 155612962
2-bromo-6-[(2-fluoro-4-isocyanophenyl)methoxy]pyridine (PubChem CID 155612962) has the molecular formula C13H8BrFN2O and a molecular weight of 307.12 g/mol. Its IUPAC name is 2-bromo-6-[(2-fluoro-4-isocyanophenyl)methoxy]pyridine.
| Compound Name | 2-bromo-6-[(2-fluoro-4-isocyanophenyl)methoxy]pyridine |
|---|---|
| PubChem CID | 155612962 |
| Molecular Formula | C13H8BrFN2O |
| Molecular Weight | 307.12 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 2-bromo-6-[(2-fluoro-4-isocyanophenyl)methoxy]pyridine |
| SMILES | [C-]#[N+]c1ccc(COc2cccc(Br)n2)c(F)c1 |
| InChI | InChI=1S/C13H8BrFN2O/c1-16-10-6-5-9(11(15)7-10)8-18-13-4-2-3-12(14)17-13/h2-7H,8H2 |
| InChIKey | VBCZAECRWCPQRK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.12 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|