C14H13BrFN3O2 — CID 166089312
N-[[5-[(6-bromo-2-pyridinyl)oxymethyl]-4-fluoro-2-pyridinyl]methyl]acetamide (PubChem CID 166089312) has the molecular formula C14H13BrFN3O2 and a molecular weight of 354.18 g/mol. Its IUPAC name is N-[[5-[(6-bromo-2-pyridinyl)oxymethyl]-4-fluoro-2-pyridinyl]methyl]acetamide.
| Compound Name | N-[[5-[(6-bromo-2-pyridinyl)oxymethyl]-4-fluoro-2-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 166089312 |
| Molecular Formula | C14H13BrFN3O2 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-[[5-[(6-bromo-2-pyridinyl)oxymethyl]-4-fluoro-2-pyridinyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cc(F)c(COc2cccc(Br)n2)cn1 |
| InChI | InChI=1S/C14H13BrFN3O2/c1-9(20)17-7-11-5-12(16)10(6-18-11)8-21-14-4-2-3-13(15)19-14/h2-6H,7-8H2,1H3,(H,17,20) |
| InChIKey | NNRFUQLDSMJFNE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|