C18H30N6O7 — CID 155613494
methyl (2S,4R)-4-azido-1-[2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoylamino]acetyl]pyrrolidine-2-carboxylate (PubChem CID 155613494) has the molecular formula C18H30N6O7 and a molecular weight of 442.47 g/mol. Its IUPAC name is methyl (2S,4R)-4-azido-1-[2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoylamino]acetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-azido-1-[2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoylamino]acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 155613494 |
| Molecular Formula | C18H30N6O7 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | methyl (2S,4R)-4-azido-1-[2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoylamino]acetyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](N=[N+]=[N-])CN1C(=O)CNC(=O)CCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N6O7/c1-18(2,3)31-17(28)20-6-8-30-7-5-14(25)21-10-15(26)24-11-12(22-23-19)9-13(24)16(27)29-4/h12-13H,5-11H2,1-4H3,(H,20,28)(H,21,25)/t12-,13+/m1/s1 |
| InChIKey | IKADYOFFLWVVCQ-OLZOCXBDSA-N |
| XLogP | 0.49 |
| TPSA | 172.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|