C37H24BN7 — CID 155614072
2,6,16,20-tetraphenyl-2,5,7,11,15,17,20-heptaza-1-borapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene (PubChem CID 155614072) has the molecular formula C37H24BN7 and a molecular weight of 577.46 g/mol. Its IUPAC name is 2,6,16,20-tetraphenyl-2,5,7,11,15,17,20-heptaza-1-borapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene.
| Compound Name | 2,6,16,20-tetraphenyl-2,5,7,11,15,17,20-heptaza-1-borapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene |
|---|---|
| PubChem CID | 155614072 |
| Molecular Formula | C37H24BN7 |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 2,6,16,20-tetraphenyl-2,5,7,11,15,17,20-heptaza-1-borapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene |
| SMILES | c1ccc(-c2ncc3c(n2)-c2cncc4c2B(N3c2ccccc2)N(c2ccccc2)c2cnc(-c3ccccc3)nc2-4)cc1 |
| InChI | InChI=1S/C37H24BN7/c1-5-13-25(14-6-1)36-40-23-31-34(42-36)29-21-39-22-30-33(29)38(44(31)27-17-9-3-10-18-27)45(28-19-11-4-12-20-28)32-24-41-37(43-35(30)32)26-15-7-2-8-16-26/h1-24H |
| InChIKey | CXZYUUVAGNRAKN-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 70.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|