C22H17ClN2O4 — CID 159862899
perchloric acid;2,4,5-triphenylpyrimidine (PubChem CID 159862899) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is perchloric acid;2,4,5-triphenylpyrimidine.
| Compound Name | perchloric acid;2,4,5-triphenylpyrimidine |
|---|---|
| PubChem CID | 159862899 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | perchloric acid;2,4,5-triphenylpyrimidine |
| SMILES | [O-][Cl+3]([O-])([O-])O.c1ccc(-c2ncc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H16N2.ClHO4/c1-4-10-17(11-5-1)20-16-23-22(19-14-8-3-9-15-19)24-21(20)18-12-6-2-7-13-18;2-1(3,4)5/h1-16H;(H,2,3,4,5) |
| InChIKey | NRJIIWJPPYSZJJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |