C35H26N4 — CID 162778163
8,8-dimethyl-4,5-diphenyl-11-(4-phenylphenyl)-3,6,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 162778163) has the molecular formula C35H26N4 and a molecular weight of 502.62 g/mol. Its IUPAC name is 8,8-dimethyl-4,5-diphenyl-11-(4-phenylphenyl)-3,6,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 8,8-dimethyl-4,5-diphenyl-11-(4-phenylphenyl)-3,6,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 162778163 |
| Molecular Formula | C35H26N4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 8,8-dimethyl-4,5-diphenyl-11-(4-phenylphenyl)-3,6,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | CC1(C)c2nc(-c3ccc(-c4ccccc4)cc3)ncc2-c2nc(-c3ccccc3)c(-c3ccccc3)nc21 |
| InChI | InChI=1S/C35H26N4/c1-35(2)32-28(22-36-34(39-32)27-20-18-24(19-21-27)23-12-6-3-7-13-23)31-33(35)38-30(26-16-10-5-11-17-26)29(37-31)25-14-8-4-9-15-25/h3-22H,1-2H3 |
| InChIKey | ZCSOABWZSRHIFK-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |