C47H35N4OPtSi-3 — CID 155616633
CID 155616633 (PubChem CID 155616633) has the molecular formula C47H35N4OPtSi-3 and a molecular weight of 894.99 g/mol.
| Compound Name | CID 155616633 |
|---|---|
| PubChem CID | 155616633 |
| Molecular Formula | C47H35N4OPtSi-3 |
| Molecular Weight | 894.99 g/mol |
| Exact Mass | 894.22 |
| IUPAC Name | — |
| SMILES | CN1[CH-]N2c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc3[Si]3(c4ccccc4-c4ccccc43)c3cccc1c32.[Pt] |
| InChI | InChI=1S/C47H35N4OSi.Pt/c1-47(2,3)30-24-25-48-45(26-30)51-37-15-8-5-12-33(37)34-22-20-31(27-39(34)51)52-32-21-23-43-40(28-32)50-29-49(4)38-16-11-19-44(46(38)50)53(43)41-17-9-6-13-35(41)36-14-7-10-18-42(36)53;/h5-26,29H,1-4H3;/q-3; |
| InChIKey | PEWSJYVUCAQBKQ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.99 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|