methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate

C10H9N3O3 — CID 15561719

IUPACmethyl 5-anilino-1,3,4-oxadiazole-2-carboxylate
SMILESCOC(=O)c1nnc(Nc2ccccc2)o1
InChIInChI=1S/C10H9N3O3/c1-15-9(14)8-12-13-10(16-8)11-7-5-3-2-4-6-7/h2-6H,1H3,(H,11,13)
InChIKeyCOXZAWNDHFCYJC-UHFFFAOYSA-N
MW219.20 g/mol
LogP1.60
Rot. Bonds3

About methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate

methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate (PubChem CID 15561719) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-anilino-1,3,4-oxadiazole-2-carboxylate
PubChem CID15561719
Molecular FormulaC10H9N3O3
Molecular Weight219.20 g/mol
Exact Mass219.06
IUPAC Namemethyl 5-anilino-1,3,4-oxadiazole-2-carboxylate
SMILESCOC(=O)c1nnc(Nc2ccccc2)o1
InChIInChI=1S/C10H9N3O3/c1-15-9(14)8-12-13-10(16-8)11-7-5-3-2-4-6-7/h2-6H,1H3,(H,11,13)
InChIKeyCOXZAWNDHFCYJC-UHFFFAOYSA-N
XLogP1.60
TPSA77.25 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.20
LogP ≤ 51.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate (CID 15561719) is methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate is COC(=O)c1nnc(Nc2ccccc2)o1.
What is the InChIKey of methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is COXZAWNDHFCYJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3/c1-15-9(14)8-12-13-10(16-8)11-7-5-3-2-4-6-7/h2-6H,1H3,(H,11,13).
What are the key properties of methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate?
methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 219.20 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-anilino-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 15561719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).