C16H14N4O2 — CID 69190593
5-(3-methylanilino)-N-phenyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 69190593) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-(3-methylanilino)-N-phenyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-(3-methylanilino)-N-phenyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 69190593 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 5-(3-methylanilino)-N-phenyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | Cc1cccc(Nc2nnc(C(=O)Nc3ccccc3)o2)c1 |
| InChI | InChI=1S/C16H14N4O2/c1-11-6-5-9-13(10-11)18-16-20-19-15(22-16)14(21)17-12-7-3-2-4-8-12/h2-10H,1H3,(H,17,21)(H,18,20) |
| InChIKey | KELFFIFBRKZDEN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |