C25H24N6O3 — CID 68684136
N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-(naphthalen-2-ylamino)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 68684136) has the molecular formula C25H24N6O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-(naphthalen-2-ylamino)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-(naphthalen-2-ylamino)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 68684136 |
| Molecular Formula | C25H24N6O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-(naphthalen-2-ylamino)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=O)c3nnc(Nc4ccc5ccccc5c4)o3)cc2)CC1 |
| InChI | InChI=1S/C25H24N6O3/c1-17(32)30-12-14-31(15-13-30)22-10-8-20(9-11-22)26-23(33)24-28-29-25(34-24)27-21-7-6-18-4-2-3-5-19(18)16-21/h2-11,16H,12-15H2,1H3,(H,26,33)(H,27,29) |
| InChIKey | IDBCRAFHFRKKQZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|