C21H19F3N6O3 — CID 68682202
N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 68682202) has the molecular formula C21H19F3N6O3 and a molecular weight of 460.42 g/mol. Its IUPAC name is N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 68682202 |
| Molecular Formula | C21H19F3N6O3 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=O)c3nnc(Nc4cc(F)c(F)cc4F)o3)cc2)CC1 |
| InChI | InChI=1S/C21H19F3N6O3/c1-12(31)29-6-8-30(9-7-29)14-4-2-13(3-5-14)25-19(32)20-27-28-21(33-20)26-18-11-16(23)15(22)10-17(18)24/h2-5,10-11H,6-9H2,1H3,(H,25,32)(H,26,28) |
| InChIKey | SZPRGVQVKYUJQA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|