C22H23FN6O3 — CID 68682761
N-[4-(4-acetyl-1,4-diazepan-1-yl)phenyl]-5-(2-fluoroanilino)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 68682761) has the molecular formula C22H23FN6O3 and a molecular weight of 438.46 g/mol. Its IUPAC name is N-[4-(4-acetyl-1,4-diazepan-1-yl)phenyl]-5-(2-fluoroanilino)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[4-(4-acetyl-1,4-diazepan-1-yl)phenyl]-5-(2-fluoroanilino)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 68682761 |
| Molecular Formula | C22H23FN6O3 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[4-(4-acetyl-1,4-diazepan-1-yl)phenyl]-5-(2-fluoroanilino)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CC(=O)N1CCCN(c2ccc(NC(=O)c3nnc(Nc4ccccc4F)o3)cc2)CC1 |
| InChI | InChI=1S/C22H23FN6O3/c1-15(30)28-11-4-12-29(14-13-28)17-9-7-16(8-10-17)24-20(31)21-26-27-22(32-21)25-19-6-3-2-5-18(19)23/h2-3,5-10H,4,11-14H2,1H3,(H,24,31)(H,25,27) |
| InChIKey | PVMUBROBOJPGND-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|