C25H24N6O4S — CID 15981023
N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-[[2-(1-benzothiophen-3-yl)acetyl]amino]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 15981023) has the molecular formula C25H24N6O4S and a molecular weight of 504.57 g/mol. Its IUPAC name is N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-[[2-(1-benzothiophen-3-yl)acetyl]amino]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-[[2-(1-benzothiophen-3-yl)acetyl]amino]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 15981023 |
| Molecular Formula | C25H24N6O4S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-5-[[2-(1-benzothiophen-3-yl)acetyl]amino]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=O)c3nnc(NC(=O)Cc4csc5ccccc45)o3)cc2)CC1 |
| InChI | InChI=1S/C25H24N6O4S/c1-16(32)30-10-12-31(13-11-30)19-8-6-18(7-9-19)26-23(34)24-28-29-25(35-24)27-22(33)14-17-15-36-21-5-3-2-4-20(17)21/h2-9,15H,10-14H2,1H3,(H,26,34)(H,27,29,33) |
| InChIKey | GKLPLZLBYABUJW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|