C23H21F3N4O5 — CID 68682439
methyl 4-[4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenoxy]cyclohexane-1-carboxylate (PubChem CID 68682439) has the molecular formula C23H21F3N4O5 and a molecular weight of 490.44 g/mol. Its IUPAC name is methyl 4-[4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenoxy]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 68682439 |
| Molecular Formula | C23H21F3N4O5 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | methyl 4-[4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenoxy]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(Oc2ccc(NC(=O)c3nnc(Nc4cc(F)c(F)cc4F)o3)cc2)CC1 |
| InChI | InChI=1S/C23H21F3N4O5/c1-33-22(32)12-2-6-14(7-3-12)34-15-8-4-13(5-9-15)27-20(31)21-29-30-23(35-21)28-19-11-17(25)16(24)10-18(19)26/h4-5,8-12,14H,2-3,6-7H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | JSHOGBLXBYRVSF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|