C24H22ClF3N4O4 — CID 68685266
(2R)-2-[4-[3-chloro-4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]propanoic acid (PubChem CID 68685266) has the molecular formula C24H22ClF3N4O4 and a molecular weight of 522.91 g/mol. Its IUPAC name is (2R)-2-[4-[3-chloro-4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]propanoic acid.
| Compound Name | (2R)-2-[4-[3-chloro-4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 68685266 |
| Molecular Formula | C24H22ClF3N4O4 |
| Molecular Weight | 522.91 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | (2R)-2-[4-[3-chloro-4-[[5-(2,4,5-trifluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]propanoic acid |
| SMILES | C[C@@H](C(=O)O)C1CCC(c2ccc(NC(=O)c3nnc(Nc4cc(F)c(F)cc4F)o3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C24H22ClF3N4O4/c1-11(23(34)35)12-2-4-13(5-3-12)14-6-7-19(15(25)8-14)29-21(33)22-31-32-24(36-22)30-20-10-17(27)16(26)9-18(20)28/h6-13H,2-5H2,1H3,(H,29,33)(H,30,32)(H,34,35)/t11-,12?,13?/m1/s1 |
| InChIKey | XXMDWLOQTLZTRU-PNESKVBLSA-N |
| XLogP | 6.13 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.91 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|