C24H40N2OSi — CID 155618825
N-[7-methyl-1-tri(propan-2-yl)silyloct-1-yn-4-yl]pyridine-2-carboxamide (PubChem CID 155618825) has the molecular formula C24H40N2OSi and a molecular weight of 400.68 g/mol. Its IUPAC name is N-[7-methyl-1-tri(propan-2-yl)silyloct-1-yn-4-yl]pyridine-2-carboxamide.
| Compound Name | N-[7-methyl-1-tri(propan-2-yl)silyloct-1-yn-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155618825 |
| Molecular Formula | C24H40N2OSi |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | N-[7-methyl-1-tri(propan-2-yl)silyloct-1-yn-4-yl]pyridine-2-carboxamide |
| SMILES | CC(C)CCC(CC#C[Si](C(C)C)(C(C)C)C(C)C)NC(=O)c1ccccn1 |
| InChI | InChI=1S/C24H40N2OSi/c1-18(2)14-15-22(26-24(27)23-13-9-10-16-25-23)12-11-17-28(19(3)4,20(5)6)21(7)8/h9-10,13,16,18-22H,12,14-15H2,1-8H3,(H,26,27) |
| InChIKey | WSGMDMNPXMDQIE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|