C16H16 — CID 155619986
1,2,3,4,5,6,8-heptadeuterio-7,9,9-trimethylfluorene (PubChem CID 155619986) has the molecular formula C16H16 and a molecular weight of 215.35 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-7,9,9-trimethylfluorene.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-7,9,9-trimethylfluorene |
|---|---|
| PubChem CID | 155619986 |
| Molecular Formula | C16H16 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-7,9,9-trimethylfluorene |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1c([2H])c([2H])c(C)c([2H])c1C2(C)C |
| InChI | InChI=1S/C16H16/c1-11-8-9-13-12-6-4-5-7-14(12)16(2,3)15(13)10-11/h4-10H,1-3H3/i4D,5D,6D,7D,8D,9D,10D |
| InChIKey | DXSIFZLOUITCRR-TWBNAIBBSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |