C36H29N3OPt — CID 155620232
3-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-6-id-1-yl]oxy-9-phenyl-2H-carbazol-2-ide;platinum(4+) (PubChem CID 155620232) has the molecular formula C36H29N3OPt and a molecular weight of 714.73 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-6-id-1-yl]oxy-9-phenyl-2H-carbazol-2-ide;platinum(4+).
| Compound Name | 3-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-6-id-1-yl]oxy-9-phenyl-2H-carbazol-2-ide;platinum(4+) |
|---|---|
| PubChem CID | 155620232 |
| Molecular Formula | C36H29N3OPt |
| Molecular Weight | 714.73 g/mol |
| Exact Mass | 714.20 |
| IUPAC Name | 3-[3-tert-butyl-5-(3-methyl-2H-benzimidazol-2-id-1-yl)benzene-6-id-1-yl]oxy-9-phenyl-2H-carbazol-2-ide;platinum(4+) |
| SMILES | CN1[CH-]N(c2[c-]c(Oc3[c-]cc4c(c3)c3ccccc3n4-c3[c-]cccc3)cc(C(C)(C)C)c2)c2ccccc21.[Pt+4] |
| InChI | InChI=1S/C36H29N3O.Pt/c1-36(2,3)25-20-27(38-24-37(4)34-16-10-11-17-35(34)38)22-29(21-25)40-28-18-19-33-31(23-28)30-14-8-9-15-32(30)39(33)26-12-6-5-7-13-26;/h5-12,14-17,19-21,23-24H,1-4H3;/q-4;+4 |
| InChIKey | SPQBJWDOEQSOBQ-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 20.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.73 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|