C18H20ClN3O5 — CID 155621115
ethyl (1S)-3-[5-(4-carbonochloridoyl-3-methyl-1,2-oxazol-5-yl)pyrazin-2-yl]oxycyclohexane-1-carboxylate (PubChem CID 155621115) has the molecular formula C18H20ClN3O5 and a molecular weight of 393.83 g/mol. Its IUPAC name is ethyl (1S)-3-[5-(4-carbonochloridoyl-3-methyl-1,2-oxazol-5-yl)pyrazin-2-yl]oxycyclohexane-1-carboxylate.
| Compound Name | ethyl (1S)-3-[5-(4-carbonochloridoyl-3-methyl-1,2-oxazol-5-yl)pyrazin-2-yl]oxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 155621115 |
| Molecular Formula | C18H20ClN3O5 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | ethyl (1S)-3-[5-(4-carbonochloridoyl-3-methyl-1,2-oxazol-5-yl)pyrazin-2-yl]oxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCC(Oc2cnc(-c3onc(C)c3C(=O)Cl)cn2)C1 |
| InChI | InChI=1S/C18H20ClN3O5/c1-3-25-18(24)11-5-4-6-12(7-11)26-14-9-20-13(8-21-14)16-15(17(19)23)10(2)22-27-16/h8-9,11-12H,3-7H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | SKVBXXLOBGWUDQ-PXYINDEMSA-N |
| XLogP | 3.32 |
| TPSA | 104.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|