C21H15ClN5O+ — CID 155621567
6-(8-chloroquinolin-6-yl)-7-(2-methyl-1H-pyrazol-2-ium-5-yl)-1H-1,8-naphthyridin-4-one (PubChem CID 155621567) has the molecular formula C21H15ClN5O+ and a molecular weight of 388.84 g/mol. Its IUPAC name is 6-(8-chloroquinolin-6-yl)-7-(2-methyl-1H-pyrazol-2-ium-5-yl)-1H-1,8-naphthyridin-4-one.
| Compound Name | 6-(8-chloroquinolin-6-yl)-7-(2-methyl-1H-pyrazol-2-ium-5-yl)-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 155621567 |
| Molecular Formula | C21H15ClN5O+ |
| Molecular Weight | 388.84 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 6-(8-chloroquinolin-6-yl)-7-(2-methyl-1H-pyrazol-2-ium-5-yl)-1H-1,8-naphthyridin-4-one |
| SMILES | C[n+]1ccc(-c2nc3[nH]ccc(=O)c3cc2-c2cc(Cl)c3ncccc3c2)[nH]1 |
| InChI | InChI=1S/C21H14ClN5O/c1-27-8-5-17(26-27)20-14(11-15-18(28)4-7-24-21(15)25-20)13-9-12-3-2-6-23-19(12)16(22)10-13/h2-11H,1H3,(H,24,25,28)/p+1 |
| InChIKey | DYWRATUVGYUMTA-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.84 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|