C32H48F3NO2 — CID 155621691
10-[3-[2-[4-(2,2,2-trifluoroacetyl)cyclohexyl]cyclopentyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroacridin-9-one (PubChem CID 155621691) has the molecular formula C32H48F3NO2 and a molecular weight of 535.74 g/mol. Its IUPAC name is 10-[3-[2-[4-(2,2,2-trifluoroacetyl)cyclohexyl]cyclopentyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroacridin-9-one.
| Compound Name | 10-[3-[2-[4-(2,2,2-trifluoroacetyl)cyclohexyl]cyclopentyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroacridin-9-one |
|---|---|
| PubChem CID | 155621691 |
| Molecular Formula | C32H48F3NO2 |
| Molecular Weight | 535.74 g/mol |
| Exact Mass | 535.36 |
| IUPAC Name | 10-[3-[2-[4-(2,2,2-trifluoroacetyl)cyclohexyl]cyclopentyl]cyclohexyl]-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroacridin-9-one |
| SMILES | O=C1C2CCCCC2N(C2CCCC(C3CCCC3C3CCC(C(=O)C(F)(F)F)CC3)C2)C2CCCCC12 |
| InChI | InChI=1S/C32H48F3NO2/c33-32(34,35)31(38)21-17-15-20(16-18-21)24-11-6-12-25(24)22-7-5-8-23(19-22)36-28-13-3-1-9-26(28)30(37)27-10-2-4-14-29(27)36/h20-29H,1-19H2 |
| InChIKey | BXWSSTRRMOVCTJ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.74 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |