C15H23ClO — CID 142043331
1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonyl chloride (PubChem CID 142043331) has the molecular formula C15H23ClO and a molecular weight of 254.80 g/mol. Its IUPAC name is 1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonyl chloride.
| Compound Name | 1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonyl chloride |
|---|---|
| PubChem CID | 142043331 |
| Molecular Formula | C15H23ClO |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene-2-carbonyl chloride |
| SMILES | O=C(Cl)C1CCC2C(CCC3CCCCC32)C1 |
| InChI | InChI=1S/C15H23ClO/c16-15(17)12-7-8-14-11(9-12)6-5-10-3-1-2-4-13(10)14/h10-14H,1-9H2 |
| InChIKey | HENPYRWPGXZDPI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|