C25H26Cl2N3OPSTl- — CID 155621835
2-[3-[[1-(2,4-dichlorophenyl)-4-methyl-5-phenylpyrazole-3-carbonyl]amino]cyclohexyl]ethynylthallium;phosphane;sulfanide (PubChem CID 155621835) has the molecular formula C25H26Cl2N3OPSTl- and a molecular weight of 722.83 g/mol. Its IUPAC name is 2-[3-[[1-(2,4-dichlorophenyl)-4-methyl-5-phenylpyrazole-3-carbonyl]amino]cyclohexyl]ethynylthallium;phosphane;sulfanide.
| Compound Name | 2-[3-[[1-(2,4-dichlorophenyl)-4-methyl-5-phenylpyrazole-3-carbonyl]amino]cyclohexyl]ethynylthallium;phosphane;sulfanide |
|---|---|
| PubChem CID | 155621835 |
| Molecular Formula | C25H26Cl2N3OPSTl- |
| Molecular Weight | 722.83 g/mol |
| Exact Mass | 722.07 |
| IUPAC Name | 2-[3-[[1-(2,4-dichlorophenyl)-4-methyl-5-phenylpyrazole-3-carbonyl]amino]cyclohexyl]ethynylthallium;phosphane;sulfanide |
| SMILES | Cc1c(C(=O)NC2CCCC(C#C[Tl])C2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccccc1.P.[SH-] |
| InChI | InChI=1S/C25H22Cl2N3O.H3P.H2S.Tl/c1-3-17-8-7-11-20(14-17)28-25(31)23-16(2)24(18-9-5-4-6-10-18)30(29-23)22-13-12-19(26)15-21(22)27;;;/h4-6,9-10,12-13,15,17,20H,7-8,11,14H2,2H3,(H,28,31);1H3;1H2;/p-1 |
| InChIKey | ITGRPSCIZDKEAC-UHFFFAOYSA-M |
| XLogP | 5.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|