C31H37F2O6S2+ — CID 155623574
(4-tert-butylphenyl)-[4-(2,2-difluoro-2-sulfoethoxy)phenyl]-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium (PubChem CID 155623574) has the molecular formula C31H37F2O6S2+ and a molecular weight of 607.76 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(2,2-difluoro-2-sulfoethoxy)phenyl]-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium.
| Compound Name | (4-tert-butylphenyl)-[4-(2,2-difluoro-2-sulfoethoxy)phenyl]-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 155623574 |
| Molecular Formula | C31H37F2O6S2+ |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(2,2-difluoro-2-sulfoethoxy)phenyl]-[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium |
| SMILES | CC1(C)COC(C)(c2ccc([S+](c3ccc(OCC(F)(F)S(=O)(=O)O)cc3)c3ccc(C(C)(C)C)cc3)cc2)OC1 |
| InChI | InChI=1S/C31H36F2O6S2/c1-28(2,3)22-7-13-25(14-8-22)40(27-17-11-24(12-18-27)37-21-31(32,33)41(34,35)36)26-15-9-23(10-16-26)30(6)38-19-29(4,5)20-39-30/h7-18H,19-21H2,1-6H3/p+1 |
| InChIKey | ZLAOTFCOVCMXKE-UHFFFAOYSA-O |
| XLogP | 7.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|