C32H38F2O6S2 — CID 155623597
2-[2-[4-bis(4-tert-butylphenyl)sulfonio-2,6-dimethylphenoxy]-2-oxoethoxy]-1,1-difluoroethanesulfonate (PubChem CID 155623597) has the molecular formula C32H38F2O6S2 and a molecular weight of 620.78 g/mol. Its IUPAC name is 2-[2-[4-bis(4-tert-butylphenyl)sulfonio-2,6-dimethylphenoxy]-2-oxoethoxy]-1,1-difluoroethanesulfonate.
| Compound Name | 2-[2-[4-bis(4-tert-butylphenyl)sulfonio-2,6-dimethylphenoxy]-2-oxoethoxy]-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 155623597 |
| Molecular Formula | C32H38F2O6S2 |
| Molecular Weight | 620.78 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | 2-[2-[4-bis(4-tert-butylphenyl)sulfonio-2,6-dimethylphenoxy]-2-oxoethoxy]-1,1-difluoroethanesulfonate |
| SMILES | Cc1cc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc(C)c1OC(=O)COCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C32H38F2O6S2/c1-21-17-27(18-22(2)29(21)40-28(35)19-39-20-32(33,34)42(36,37)38)41(25-13-9-23(10-14-25)30(3,4)5)26-15-11-24(12-16-26)31(6,7)8/h9-18H,19-20H2,1-8H3 |
| InChIKey | YXUIOJXCIIPBAK-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.78 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|