C23H29Cl2N3O — CID 155623754
6-[(3aR,6aS)-3a,5-diethyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-one (PubChem CID 155623754) has the molecular formula C23H29Cl2N3O and a molecular weight of 434.41 g/mol. Its IUPAC name is 6-[(3aR,6aS)-3a,5-diethyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-one.
| Compound Name | 6-[(3aR,6aS)-3a,5-diethyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 155623754 |
| Molecular Formula | C23H29Cl2N3O |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 6-[(3aR,6aS)-3a,5-diethyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-one |
| SMILES | CCC1C[C@@H]2CN(c3nc(C)n(-c4cccc(Cl)c4Cl)c(=O)c3C)C[C@]2(CC)C1 |
| InChI | InChI=1S/C23H29Cl2N3O/c1-5-16-10-17-12-27(13-23(17,6-2)11-16)21-14(3)22(29)28(15(4)26-21)19-9-7-8-18(24)20(19)25/h7-9,16-17H,5-6,10-13H2,1-4H3/t16?,17-,23+/m1/s1 |
| InChIKey | JNJYUIRTPVMJOM-QKBBCMBSSA-N |
| XLogP | 5.81 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |