C20H23Cl2F3N4O — CID 155709858
6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(2,3-dichlorophenyl)-2-methyl-5-(trifluoromethyl)pyrimidin-4-one;methanamine (PubChem CID 155709858) has the molecular formula C20H23Cl2F3N4O and a molecular weight of 463.33 g/mol. Its IUPAC name is 6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(2,3-dichlorophenyl)-2-methyl-5-(trifluoromethyl)pyrimidin-4-one;methanamine.
| Compound Name | 6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(2,3-dichlorophenyl)-2-methyl-5-(trifluoromethyl)pyrimidin-4-one;methanamine |
|---|---|
| PubChem CID | 155709858 |
| Molecular Formula | C20H23Cl2F3N4O |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 6-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(2,3-dichlorophenyl)-2-methyl-5-(trifluoromethyl)pyrimidin-4-one;methanamine |
| SMILES | CN.Cc1nc(N2CC3CCCC3C2)c(C(F)(F)F)c(=O)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H18Cl2F3N3O.CH5N/c1-10-25-17(26-8-11-4-2-5-12(11)9-26)15(19(22,23)24)18(28)27(10)14-7-3-6-13(20)16(14)21;1-2/h3,6-7,11-12H,2,4-5,8-9H2,1H3;2H2,1H3 |
| InChIKey | AJMYWDIVNBVEFN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |