C50H37IrN3O-2 — CID 155623945
2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3-phenylbenzene-6-id-1-yl)-1,3-benzoxazole (PubChem CID 155623945) has the molecular formula C50H37IrN3O-2 and a molecular weight of 888.08 g/mol. Its IUPAC name is 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3-phenylbenzene-6-id-1-yl)-1,3-benzoxazole.
| Compound Name | 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3-phenylbenzene-6-id-1-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 155623945 |
| Molecular Formula | C50H37IrN3O-2 |
| Molecular Weight | 888.08 g/mol |
| Exact Mass | 888.26 |
| IUPAC Name | 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3-phenylbenzene-6-id-1-yl)-1,3-benzoxazole |
| SMILES | Cc1cccc(C)c1-c1nc(-c2[c-]cc3c(c2)C(C)(C)c2ccccc2-3)nc2ccccc12.[Ir].[c-]1ccc(-c2ccccc2)cc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C31H25N2.C19H12NO.Ir/c1-19-10-9-11-20(2)28(19)29-24-13-6-8-15-27(24)32-30(33-29)21-16-17-23-22-12-5-7-14-25(22)31(3,4)26(23)18-21;1-2-7-14(8-3-1)15-9-6-10-16(13-15)19-20-17-11-4-5-12-18(17)21-19;/h5-15,17-18H,1-4H3;1-9,11-13H;/q2*-1; |
| InChIKey | DWSHTVHKDIQDCN-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.08 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|