C48H37IrN3-2 — CID 155623974
2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3-phenylbenzene-6-id-1-yl)pyridine (PubChem CID 155623974) has the molecular formula C48H37IrN3-2 and a molecular weight of 848.06 g/mol. Its IUPAC name is 2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3-phenylbenzene-6-id-1-yl)pyridine.
| Compound Name | 2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3-phenylbenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 155623974 |
| Molecular Formula | C48H37IrN3-2 |
| Molecular Weight | 848.06 g/mol |
| Exact Mass | 848.26 |
| IUPAC Name | 2-(9,9-dimethyl-2H-fluoren-2-id-3-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3-phenylbenzene-6-id-1-yl)pyridine |
| SMILES | Cc1cccc(C)c1-c1nc(-c2[c-]cc3c(c2)-c2ccccc2C3(C)C)nc2ccccc12.[Ir].[c-]1ccc(-c2ccccc2)cc1-c1ccccn1 |
| InChI | InChI=1S/C31H25N2.C17H12N.Ir/c1-19-10-9-11-20(2)28(19)29-23-13-6-8-15-27(23)32-30(33-29)21-16-17-26-24(18-21)22-12-5-7-14-25(22)31(26,3)4;1-2-7-14(8-3-1)15-9-6-10-16(13-15)17-11-4-5-12-18-17;/h5-15,17-18H,1-4H3;1-9,11-13H;/q2*-1; |
| InChIKey | BJQZZUJCUFFCQN-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.06 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|