C50H39IrN3S-2 — CID 155623942
2-(9,9-diethyl-2H-fluoren-2-id-3-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3H-naphthalen-3-id-2-yl)-1,3-benzothiazole (PubChem CID 155623942) has the molecular formula C50H39IrN3S-2 and a molecular weight of 906.17 g/mol. Its IUPAC name is 2-(9,9-diethyl-2H-fluoren-2-id-3-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3H-naphthalen-3-id-2-yl)-1,3-benzothiazole.
| Compound Name | 2-(9,9-diethyl-2H-fluoren-2-id-3-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3H-naphthalen-3-id-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 155623942 |
| Molecular Formula | C50H39IrN3S-2 |
| Molecular Weight | 906.17 g/mol |
| Exact Mass | 906.25 |
| IUPAC Name | 2-(9,9-diethyl-2H-fluoren-2-id-3-yl)-4-(2,6-dimethylphenyl)quinazoline;iridium;2-(3H-naphthalen-3-id-2-yl)-1,3-benzothiazole |
| SMILES | CCC1(CC)c2c[c-]c(-c3nc(-c4c(C)cccc4C)c4ccccc4n3)cc2-c2ccccc21.[Ir].[c-]1cc2ccccc2cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C33H29N2.C17H10NS.Ir/c1-5-33(6-2)27-16-9-7-14-24(27)26-20-23(18-19-28(26)33)32-34-29-17-10-8-15-25(29)31(35-32)30-21(3)12-11-13-22(30)4;1-2-6-13-11-14(10-9-12(13)5-1)17-18-15-7-3-4-8-16(15)19-17;/h7-17,19-20H,5-6H2,1-4H3;1-9,11H;/q2*-1; |
| InChIKey | SXIVAGGCSFEDPN-UHFFFAOYSA-N |
| XLogP | 13.38 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.17 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|