C25H30ClFN8O4 — CID 155624422
2-[4-chloro-2-[[4-[4-[3-[(dimethylamino)methyl]azetidin-1-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-5-fluorophenyl]propan-2-ol (PubChem CID 155624422) has the molecular formula C25H30ClFN8O4 and a molecular weight of 561.02 g/mol. Its IUPAC name is 2-[4-chloro-2-[[4-[4-[3-[(dimethylamino)methyl]azetidin-1-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-5-fluorophenyl]propan-2-ol.
| Compound Name | 2-[4-chloro-2-[[4-[4-[3-[(dimethylamino)methyl]azetidin-1-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-5-fluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 155624422 |
| Molecular Formula | C25H30ClFN8O4 |
| Molecular Weight | 561.02 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 2-[4-chloro-2-[[4-[4-[3-[(dimethylamino)methyl]azetidin-1-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-5-fluorophenyl]propan-2-ol |
| SMILES | COc1cc(N2CC(CN(C)C)C2)c([N+](=O)[O-])cc1Nc1ncnc(Nc2cc(Cl)c(F)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C25H30ClFN8O4/c1-25(2,36)15-6-17(27)16(26)7-18(15)30-23-28-13-29-24(32-23)31-19-8-21(35(37)38)20(9-22(19)39-5)34-11-14(12-34)10-33(3)4/h6-9,13-14,36H,10-12H2,1-5H3,(H2,28,29,30,31,32) |
| InChIKey | GHWSXYPYQYCFOA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.02 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|