C24H29F3N8O4 — CID 155624499
2-[2-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 155624499) has the molecular formula C24H29F3N8O4 and a molecular weight of 550.54 g/mol. Its IUPAC name is 2-[2-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[2-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 155624499 |
| Molecular Formula | C24H29F3N8O4 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | 2-[2-[[4-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncnc(Nc2ccccc2C(C)(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C24H29F3N8O4/c1-23(36,24(25,26)27)15-8-6-7-9-16(15)30-21-28-14-29-22(32-21)31-17-12-19(35(37)38)18(13-20(17)39-5)34(4)11-10-33(2)3/h6-9,12-14,36H,10-11H2,1-5H3,(H2,28,29,30,31,32) |
| InChIKey | SBKHBYDDMCRRQH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|