C27H34ClFN8O4 — CID 155624509
2-[4-chloro-5-fluoro-2-[[4-[2-methoxy-4-[methyl(2-piperidin-1-ylethyl)amino]-5-nitroanilino]-1,3,5-triazin-2-yl]amino]phenyl]propan-2-ol (PubChem CID 155624509) has the molecular formula C27H34ClFN8O4 and a molecular weight of 589.07 g/mol. Its IUPAC name is 2-[4-chloro-5-fluoro-2-[[4-[2-methoxy-4-[methyl(2-piperidin-1-ylethyl)amino]-5-nitroanilino]-1,3,5-triazin-2-yl]amino]phenyl]propan-2-ol.
| Compound Name | 2-[4-chloro-5-fluoro-2-[[4-[2-methoxy-4-[methyl(2-piperidin-1-ylethyl)amino]-5-nitroanilino]-1,3,5-triazin-2-yl]amino]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 155624509 |
| Molecular Formula | C27H34ClFN8O4 |
| Molecular Weight | 589.07 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | 2-[4-chloro-5-fluoro-2-[[4-[2-methoxy-4-[methyl(2-piperidin-1-ylethyl)amino]-5-nitroanilino]-1,3,5-triazin-2-yl]amino]phenyl]propan-2-ol |
| SMILES | COc1cc(N(C)CCN2CCCCC2)c([N+](=O)[O-])cc1Nc1ncnc(Nc2cc(Cl)c(F)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C27H34ClFN8O4/c1-27(2,38)17-12-19(29)18(28)13-20(17)32-25-30-16-31-26(34-25)33-21-14-23(37(39)40)22(15-24(21)41-4)35(3)10-11-36-8-6-5-7-9-36/h12-16,38H,5-11H2,1-4H3,(H2,30,31,32,33,34) |
| InChIKey | PBJVTRDPSNCAGZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.07 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|