C18H23N3O4 — CID 155624552
[6-[4-(aminomethyl)-3-methyl-1,2-oxazol-5-yl]-2-methyl-3-pyridinyl] cyclohexanecarboperoxoate (PubChem CID 155624552) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is [6-[4-(aminomethyl)-3-methyl-1,2-oxazol-5-yl]-2-methyl-3-pyridinyl] cyclohexanecarboperoxoate.
| Compound Name | [6-[4-(aminomethyl)-3-methyl-1,2-oxazol-5-yl]-2-methyl-3-pyridinyl] cyclohexanecarboperoxoate |
|---|---|
| PubChem CID | 155624552 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | [6-[4-(aminomethyl)-3-methyl-1,2-oxazol-5-yl]-2-methyl-3-pyridinyl] cyclohexanecarboperoxoate |
| SMILES | Cc1nc(-c2onc(C)c2CN)ccc1OOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H23N3O4/c1-11-14(10-19)17(23-21-11)15-8-9-16(12(2)20-15)24-25-18(22)13-6-4-3-5-7-13/h8-9,13H,3-7,10,19H2,1-2H3 |
| InChIKey | RAGRZWXZBGIQBW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|