C24H34BN3O5 — CID 174050413
[3-methyl-5-[6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,2-oxazol-4-yl]methyl N-cyclopentyl-N-methylcarbamate (PubChem CID 174050413) has the molecular formula C24H34BN3O5 and a molecular weight of 455.36 g/mol. Its IUPAC name is [3-methyl-5-[6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,2-oxazol-4-yl]methyl N-cyclopentyl-N-methylcarbamate.
| Compound Name | [3-methyl-5-[6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,2-oxazol-4-yl]methyl N-cyclopentyl-N-methylcarbamate |
|---|---|
| PubChem CID | 174050413 |
| Molecular Formula | C24H34BN3O5 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | [3-methyl-5-[6-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-1,2-oxazol-4-yl]methyl N-cyclopentyl-N-methylcarbamate |
| SMILES | Cc1nc(-c2onc(C)c2COC(=O)N(C)C2CCCC2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H34BN3O5/c1-15-18(14-30-22(29)28(7)17-10-8-9-11-17)21(31-27-15)20-13-12-19(16(2)26-20)25-32-23(3,4)24(5,6)33-25/h12-13,17H,8-11,14H2,1-7H3 |
| InChIKey | GLXMOSJQCRFCAZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 86.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|