C65H39N7 — CID 155628103
3-[9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-4-yl)phenyl]-7-(3-isocyanophenyl)carbazol-2-yl]benzonitrile (PubChem CID 155628103) has the molecular formula C65H39N7 and a molecular weight of 918.08 g/mol. Its IUPAC name is 3-[9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-4-yl)phenyl]-7-(3-isocyanophenyl)carbazol-2-yl]benzonitrile.
| Compound Name | 3-[9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-4-yl)phenyl]-7-(3-isocyanophenyl)carbazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 155628103 |
| Molecular Formula | C65H39N7 |
| Molecular Weight | 918.08 g/mol |
| Exact Mass | 917.33 |
| IUPAC Name | 3-[9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-4-yl)phenyl]-7-(3-isocyanophenyl)carbazol-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c4ccc(-c5cccc(C#N)c5)cc4n(-c4ccc(-c5cccc6c5c5ccccc5n6-c5ccccc5)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)c1 |
| InChI | InChI=1S/C65H39N7/c1-67-50-23-14-22-46(37-50)48-31-34-54-53-33-30-47(45-21-13-16-42(36-45)41-66)39-60(53)72(61(54)40-48)58-35-32-49(52-27-15-29-59-62(52)55-26-11-12-28-57(55)71(59)51-24-9-4-10-25-51)38-56(58)65-69-63(43-17-5-2-6-18-43)68-64(70-65)44-19-7-3-8-20-44/h2-40H |
| InChIKey | FTBRTKAMILEZHF-UHFFFAOYSA-N |
| XLogP | 16.49 |
| TPSA | 76.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.08 |
| LogP ≤ 5 | 16.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|