C67H37N9 — CID 155628177
5-[7-(3-cyano-5-isocyanophenyl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-1-yl)phenyl]carbazol-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 155628177) has the molecular formula C67H37N9 and a molecular weight of 968.10 g/mol. Its IUPAC name is 5-[7-(3-cyano-5-isocyanophenyl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-1-yl)phenyl]carbazol-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[7-(3-cyano-5-isocyanophenyl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-1-yl)phenyl]carbazol-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 155628177 |
| Molecular Formula | C67H37N9 |
| Molecular Weight | 968.10 g/mol |
| Exact Mass | 967.32 |
| IUPAC Name | 5-[7-(3-cyano-5-isocyanophenyl)-9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(9-phenylcarbazol-1-yl)phenyl]carbazol-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc3c4ccc(-c5cc(C#N)cc(C#N)c5)cc4n(-c4ccc(-c5cccc6c7ccccc7n(-c7ccccc7)c56)cc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2)c1 |
| InChI | InChI=1S/C67H37N9/c1-71-52-34-44(41-70)33-51(35-52)48-25-28-57-56-27-24-47(50-31-42(39-68)30-43(32-50)40-69)37-62(56)76(63(57)38-48)61-29-26-49(54-21-13-22-58-55-20-11-12-23-60(55)75(64(54)58)53-18-9-4-10-19-53)36-59(61)67-73-65(45-14-5-2-6-15-45)72-66(74-67)46-16-7-3-8-17-46/h2-38H |
| InChIKey | VAMOQQKWWLNVDT-UHFFFAOYSA-N |
| XLogP | 16.23 |
| TPSA | 124.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.10 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|