C52H32N6 — CID 155628228
1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-isocyanocarbazol-9-yl)phenyl]-9-phenylcarbazole (PubChem CID 155628228) has the molecular formula C52H32N6 and a molecular weight of 740.87 g/mol. Its IUPAC name is 1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-isocyanocarbazol-9-yl)phenyl]-9-phenylcarbazole.
| Compound Name | 1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-isocyanocarbazol-9-yl)phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 155628228 |
| Molecular Formula | C52H32N6 |
| Molecular Weight | 740.87 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | 1-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-isocyanocarbazol-9-yl)phenyl]-9-phenylcarbazole |
| SMILES | [C-]#[N+]c1ccc2c3ccccc3n(-c3ccc(-c4cccc5c6ccccc6n(-c6ccccc6)c45)cc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2c1 |
| InChI | InChI=1S/C52H32N6/c1-53-37-29-30-42-40-22-11-14-27-46(40)58(48(42)33-37)47-31-28-36(39-24-15-25-43-41-23-12-13-26-45(41)57(49(39)43)38-20-9-4-10-21-38)32-44(47)52-55-50(34-16-5-2-6-17-34)54-51(56-52)35-18-7-3-8-19-35/h2-33H |
| InChIKey | FBLQRSJMFOFFCW-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 52.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.87 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|