C21H24FN3O4 — CID 155629372
5-(butoxymethyl)-4-ethyl-2-(7-fluoro-1-oxo-4-prop-1-en-2-ylisochromen-6-yl)-1,2,4-triazol-3-one (PubChem CID 155629372) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is 5-(butoxymethyl)-4-ethyl-2-(7-fluoro-1-oxo-4-prop-1-en-2-ylisochromen-6-yl)-1,2,4-triazol-3-one.
| Compound Name | 5-(butoxymethyl)-4-ethyl-2-(7-fluoro-1-oxo-4-prop-1-en-2-ylisochromen-6-yl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155629372 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 5-(butoxymethyl)-4-ethyl-2-(7-fluoro-1-oxo-4-prop-1-en-2-ylisochromen-6-yl)-1,2,4-triazol-3-one |
| SMILES | C=C(C)c1coc(=O)c2cc(F)c(-n3nc(COCCCC)n(CC)c3=O)cc12 |
| InChI | InChI=1S/C21H24FN3O4/c1-5-7-8-28-12-19-23-25(21(27)24(19)6-2)18-10-14-15(9-17(18)22)20(26)29-11-16(14)13(3)4/h9-11H,3,5-8,12H2,1-2,4H3 |
| InChIKey | UCXOOOIOMGHSJJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 79.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|