C33H36F5N7O3 — CID 155630035
tert-butyl (2R)-4-[8-fluoro-7-[3-fluoro-2-(trifluoromethyl)phenyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate (PubChem CID 155630035) has the molecular formula C33H36F5N7O3 and a molecular weight of 673.69 g/mol. Its IUPAC name is tert-butyl (2R)-4-[8-fluoro-7-[3-fluoro-2-(trifluoromethyl)phenyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[8-fluoro-7-[3-fluoro-2-(trifluoromethyl)phenyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155630035 |
| Molecular Formula | C33H36F5N7O3 |
| Molecular Weight | 673.69 g/mol |
| Exact Mass | 673.28 |
| IUPAC Name | tert-butyl (2R)-4-[8-fluoro-7-[3-fluoro-2-(trifluoromethyl)phenyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazine-1-carboxylate |
| SMILES | [C-]#[N+]C[C@H]1CN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc(F)c4C(F)(F)F)ncc23)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H36F5N7O3/c1-31(2,3)48-30(46)45-15-14-43(18-20(45)16-39-4)28-22-17-40-26(21-8-5-9-23(34)24(21)33(36,37)38)25(35)27(22)41-29(42-28)47-19-32-10-6-12-44(32)13-7-11-32/h5,8-9,17,20H,6-7,10-16,18-19H2,1-3H3/t20-/m0/s1 |
| InChIKey | XVLWZKKKMFEBHP-FQEVSTJZSA-N |
| XLogP | 6.34 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|