C17H11FN4O — CID 155630281
4-(4-amino-8-fluoropyrido[4,3-d]pyrimidin-7-yl)naphthalen-2-ol (PubChem CID 155630281) has the molecular formula C17H11FN4O and a molecular weight of 306.30 g/mol. Its IUPAC name is 4-(4-amino-8-fluoropyrido[4,3-d]pyrimidin-7-yl)naphthalen-2-ol.
| Compound Name | 4-(4-amino-8-fluoropyrido[4,3-d]pyrimidin-7-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 155630281 |
| Molecular Formula | C17H11FN4O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-(4-amino-8-fluoropyrido[4,3-d]pyrimidin-7-yl)naphthalen-2-ol |
| SMILES | Nc1ncnc2c(F)c(-c3cc(O)cc4ccccc34)ncc12 |
| InChI | InChI=1S/C17H11FN4O/c18-14-15(20-7-13-16(14)21-8-22-17(13)19)12-6-10(23)5-9-3-1-2-4-11(9)12/h1-8,23H,(H2,19,21,22) |
| InChIKey | WYJNCBGYKURRPP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |