C26H23F4N5O2 — CID 164521427
4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(3,3,3-trifluoropropoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 164521427) has the molecular formula C26H23F4N5O2 and a molecular weight of 513.50 g/mol. Its IUPAC name is 4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(3,3,3-trifluoropropoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(3,3,3-trifluoropropoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 164521427 |
| Molecular Formula | C26H23F4N5O2 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(3,3,3-trifluoropropoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | Oc1cc(-c2ncc3c(N4C[C@H]5CC[C@@H](C4)N5)nc(OCCC(F)(F)F)nc3c2F)c2ccccc2c1 |
| InChI | InChI=1S/C26H23F4N5O2/c27-21-22(19-10-17(36)9-14-3-1-2-4-18(14)19)31-11-20-23(21)33-25(37-8-7-26(28,29)30)34-24(20)35-12-15-5-6-16(13-35)32-15/h1-4,9-11,15-16,32,36H,5-8,12-13H2/t15-,16+ |
| InChIKey | QVBUBKNWRZXEED-IYBDPMFKSA-N |
| XLogP | 4.96 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |