C26H22ClF4N5O2 — CID 164521279
5-chloro-4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(3,3,3-trifluoropropoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 164521279) has the molecular formula C26H22ClF4N5O2 and a molecular weight of 547.94 g/mol. Its IUPAC name is 5-chloro-4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(3,3,3-trifluoropropoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | 5-chloro-4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(3,3,3-trifluoropropoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 164521279 |
| Molecular Formula | C26H22ClF4N5O2 |
| Molecular Weight | 547.94 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 5-chloro-4-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-(3,3,3-trifluoropropoxy)pyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | Oc1cc(-c2ncc3c(N4C[C@H]5CC[C@@H](C4)N5)nc(OCCC(F)(F)F)nc3c2F)c2c(Cl)cccc2c1 |
| InChI | InChI=1S/C26H22ClF4N5O2/c27-19-3-1-2-13-8-16(37)9-17(20(13)19)22-21(28)23-18(10-32-22)24(36-11-14-4-5-15(12-36)33-14)35-25(34-23)38-7-6-26(29,30)31/h1-3,8-10,14-15,33,37H,4-7,11-12H2/t14-,15+ |
| InChIKey | KQOKZROVLAGDAJ-GASCZTMLSA-N |
| XLogP | 5.61 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.94 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |