C16H14N4O3 — CID 155632012
6-[dideuterio(1H-pyrazol-4-yl)methyl]-3-(111C)methoxy-2-(3-nitrophenyl)pyridine (PubChem CID 155632012) has the molecular formula C16H14N4O3 and a molecular weight of 311.33 g/mol. Its IUPAC name is 6-[dideuterio(1H-pyrazol-4-yl)methyl]-3-(111C)methoxy-2-(3-nitrophenyl)pyridine.
| Compound Name | 6-[dideuterio(1H-pyrazol-4-yl)methyl]-3-(111C)methoxy-2-(3-nitrophenyl)pyridine |
|---|---|
| PubChem CID | 155632012 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 6-[dideuterio(1H-pyrazol-4-yl)methyl]-3-(111C)methoxy-2-(3-nitrophenyl)pyridine |
| SMILES | [2H]C([2H])(c1cn[nH]c1)c1ccc(O[11CH3])c(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H14N4O3/c1-23-15-6-5-13(7-11-9-17-18-10-11)19-16(15)12-3-2-4-14(8-12)20(21)22/h2-6,8-10H,7H2,1H3,(H,17,18)/i1-1,7D2 |
| InChIKey | CCLBPIKWQKSPNY-YVBXTNFUSA-N |
| XLogP | 2.98 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|