C36H41BrN4O8 — CID 160533597
6-(bromomethyl)-3-methoxy-2-(3-nitrophenyl)pyridine;cyclopentanol;6-(cyclopentyloxymethyl)-3-methoxy-2-(3-nitrophenyl)pyridine (PubChem CID 160533597) has the molecular formula C36H41BrN4O8 and a molecular weight of 737.65 g/mol. Its IUPAC name is 6-(bromomethyl)-3-methoxy-2-(3-nitrophenyl)pyridine;cyclopentanol;6-(cyclopentyloxymethyl)-3-methoxy-2-(3-nitrophenyl)pyridine.
| Compound Name | 6-(bromomethyl)-3-methoxy-2-(3-nitrophenyl)pyridine;cyclopentanol;6-(cyclopentyloxymethyl)-3-methoxy-2-(3-nitrophenyl)pyridine |
|---|---|
| PubChem CID | 160533597 |
| Molecular Formula | C36H41BrN4O8 |
| Molecular Weight | 737.65 g/mol |
| Exact Mass | 736.21 |
| IUPAC Name | 6-(bromomethyl)-3-methoxy-2-(3-nitrophenyl)pyridine;cyclopentanol;6-(cyclopentyloxymethyl)-3-methoxy-2-(3-nitrophenyl)pyridine |
| SMILES | COc1ccc(CBr)nc1-c1cccc([N+](=O)[O-])c1.COc1ccc(COC2CCCC2)nc1-c1cccc([N+](=O)[O-])c1.OC1CCCC1 |
| InChI | InChI=1S/C18H20N2O4.C13H11BrN2O3.C5H10O/c1-23-17-10-9-14(12-24-16-7-2-3-8-16)19-18(17)13-5-4-6-15(11-13)20(21)22;1-19-12-6-5-10(8-14)15-13(12)9-3-2-4-11(7-9)16(17)18;6-5-3-1-2-4-5/h4-6,9-11,16H,2-3,7-8,12H2,1H3;2-7H,8H2,1H3;5-6H,1-4H2 |
| InChIKey | QVWGLJWBLABHEB-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.65 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|