C20H30ClN5O3SSi — CID 155632646
N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(5-chloro-2-pyridinyl)piperazine-1-sulfonamide (PubChem CID 155632646) has the molecular formula C20H30ClN5O3SSi and a molecular weight of 484.10 g/mol. Its IUPAC name is N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(5-chloro-2-pyridinyl)piperazine-1-sulfonamide.
| Compound Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(5-chloro-2-pyridinyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 155632646 |
| Molecular Formula | C20H30ClN5O3SSi |
| Molecular Weight | 484.10 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(5-chloro-2-pyridinyl)piperazine-1-sulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NS(=O)(=O)N2CCN(c3ccc(Cl)cn3)CC2)nc1 |
| InChI | InChI=1S/C20H30ClN5O3SSi/c1-20(2,3)31(4,5)29-17-7-8-18(22-15-17)24-30(27,28)26-12-10-25(11-13-26)19-9-6-16(21)14-23-19/h6-9,14-15H,10-13H2,1-5H3,(H,22,24) |
| InChIKey | DAWLKOGVSDGRHD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.10 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|